C12H9F6O3S- — CID 162509141
1,1,1,3,3,3-hexafluoro-2-(2-phenylsulfanylethoxycarbonyl)propan-2-olate (PubChem CID 162509141) has the molecular formula C12H9F6O3S- and a molecular weight of 347.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-phenylsulfanylethoxycarbonyl)propan-2-olate.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-phenylsulfanylethoxycarbonyl)propan-2-olate |
|---|---|
| PubChem CID | 162509141 |
| Molecular Formula | C12H9F6O3S- |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-phenylsulfanylethoxycarbonyl)propan-2-olate |
| SMILES | O=C(OCCSc1ccccc1)C([O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H9F6O3S/c13-11(14,15)10(20,12(16,17)18)9(19)21-6-7-22-8-4-2-1-3-5-8/h1-5H,6-7H2/q-1 |
| InChIKey | CXXQYVULQLCKKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|