C13H13F3O3S — CID 135040659
ethyl (2S)-4-phenylsulfanyl-2-(trifluoromethyl)oxetane-2-carboxylate (PubChem CID 135040659) has the molecular formula C13H13F3O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is ethyl (2S)-4-phenylsulfanyl-2-(trifluoromethyl)oxetane-2-carboxylate.
| Compound Name | ethyl (2S)-4-phenylsulfanyl-2-(trifluoromethyl)oxetane-2-carboxylate |
|---|---|
| PubChem CID | 135040659 |
| Molecular Formula | C13H13F3O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | ethyl (2S)-4-phenylsulfanyl-2-(trifluoromethyl)oxetane-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(F)(F)F)CC(Sc2ccccc2)O1 |
| InChI | InChI=1S/C13H13F3O3S/c1-2-18-11(17)12(13(14,15)16)8-10(19-12)20-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3/t10?,12-/m0/s1 |
| InChIKey | YYTPBDOINNBLCN-KFJBMODSSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |