C16H21FO4S — CID 141351717
tert-butyl 2-[3-(4-fluorophenyl)sulfanyl-4-oxobutoxy]acetate (PubChem CID 141351717) has the molecular formula C16H21FO4S and a molecular weight of 328.40 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-fluorophenyl)sulfanyl-4-oxobutoxy]acetate.
| Compound Name | tert-butyl 2-[3-(4-fluorophenyl)sulfanyl-4-oxobutoxy]acetate |
|---|---|
| PubChem CID | 141351717 |
| Molecular Formula | C16H21FO4S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | tert-butyl 2-[3-(4-fluorophenyl)sulfanyl-4-oxobutoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCC(C=O)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FO4S/c1-16(2,3)21-15(19)11-20-9-8-14(10-18)22-13-6-4-12(17)5-7-13/h4-7,10,14H,8-9,11H2,1-3H3 |
| InChIKey | GDUXBURJRLVFLP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|