C18H26BFO4S — CID 140722307
ethyl 4-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylbutanoate (PubChem CID 140722307) has the molecular formula C18H26BFO4S and a molecular weight of 368.28 g/mol. Its IUPAC name is ethyl 4-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylbutanoate.
| Compound Name | ethyl 4-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 140722307 |
| Molecular Formula | C18H26BFO4S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | ethyl 4-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfanylbutanoate |
| SMILES | CCOC(=O)CCCSc1ccc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C18H26BFO4S/c1-6-22-16(21)8-7-11-25-15-10-9-13(12-14(15)20)19-23-17(2,3)18(4,5)24-19/h9-10,12H,6-8,11H2,1-5H3 |
| InChIKey | BIRWWJBIPMSECF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|