C26H19F2N5O2S — CID 162510947
N-[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]-2-methoxy-5-(4-pyridazin-4-ylquinolin-6-yl)pyridin-3-amine (PubChem CID 162510947) has the molecular formula C26H19F2N5O2S and a molecular weight of 503.53 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]-2-methoxy-5-(4-pyridazin-4-ylquinolin-6-yl)pyridin-3-amine.
| Compound Name | N-[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]-2-methoxy-5-(4-pyridazin-4-ylquinolin-6-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 162510947 |
| Molecular Formula | C26H19F2N5O2S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | N-[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]-2-methoxy-5-(4-pyridazin-4-ylquinolin-6-yl)pyridin-3-amine |
| SMILES | C=S(=O)(Nc1cc(-c2ccc3nccc(-c4ccnnc4)c3c2)cnc1OC)c1ccc(F)cc1F |
| InChI | InChI=1S/C26H19F2N5O2S/c1-35-26-24(33-36(2,34)25-6-4-19(27)13-22(25)28)12-18(14-30-26)16-3-5-23-21(11-16)20(8-9-29-23)17-7-10-31-32-15-17/h3-15H,2H2,1H3,(H,33,34) |
| InChIKey | WQEUGSAFJRVUPO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|