C29H26F2N4O4S — CID 162669761
2,4-difluoro-N-[2-methoxy-5-[4-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-en-2-yl]quinolin-6-yl]-3-pyridinyl]benzenesulfonamide (PubChem CID 162669761) has the molecular formula C29H26F2N4O4S and a molecular weight of 564.61 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-methoxy-5-[4-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-en-2-yl]quinolin-6-yl]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-[2-methoxy-5-[4-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-en-2-yl]quinolin-6-yl]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162669761 |
| Molecular Formula | C29H26F2N4O4S |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 2,4-difluoro-N-[2-methoxy-5-[4-[(E)-4-oxo-4-pyrrolidin-1-ylbut-2-en-2-yl]quinolin-6-yl]-3-pyridinyl]benzenesulfonamide |
| SMILES | COc1ncc(-c2ccc3nccc(/C(C)=C/C(=O)N4CCCC4)c3c2)cc1NS(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C29H26F2N4O4S/c1-18(13-28(36)35-11-3-4-12-35)22-9-10-32-25-7-5-19(14-23(22)25)20-15-26(29(39-2)33-17-20)34-40(37,38)27-8-6-21(30)16-24(27)31/h5-10,13-17,34H,3-4,11-12H2,1-2H3/b18-13+ |
| InChIKey | MLVGNMUJLBIZJL-QGOAFFKASA-N |
| XLogP | 5.41 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|