C16H15Cl2F3N4O — CID 162513941
5-chloro-4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,2-dimethylaziridin-1-yl]-6-ethylpyrimidine (PubChem CID 162513941) has the molecular formula C16H15Cl2F3N4O and a molecular weight of 407.22 g/mol. Its IUPAC name is 5-chloro-4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,2-dimethylaziridin-1-yl]-6-ethylpyrimidine.
| Compound Name | 5-chloro-4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,2-dimethylaziridin-1-yl]-6-ethylpyrimidine |
|---|---|
| PubChem CID | 162513941 |
| Molecular Formula | C16H15Cl2F3N4O |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 5-chloro-4-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-2,2-dimethylaziridin-1-yl]-6-ethylpyrimidine |
| SMILES | CCc1ncnc(N2C(Oc3ncc(C(F)(F)F)cc3Cl)C2(C)C)c1Cl |
| InChI | InChI=1S/C16H15Cl2F3N4O/c1-4-10-11(18)12(24-7-23-10)25-14(15(25,2)3)26-13-9(17)5-8(6-22-13)16(19,20)21/h5-7,14H,4H2,1-3H3 |
| InChIKey | BPKQYYXVEADGNI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|