C13H11ClF3N4O2- — CID 59371227
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-ethyl-N-methylpyrazole-1-carboximidate (PubChem CID 59371227) has the molecular formula C13H11ClF3N4O2- and a molecular weight of 347.70 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-ethyl-N-methylpyrazole-1-carboximidate.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-ethyl-N-methylpyrazole-1-carboximidate |
|---|---|
| PubChem CID | 59371227 |
| Molecular Formula | C13H11ClF3N4O2- |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-ethyl-N-methylpyrazole-1-carboximidate |
| SMILES | CCc1cc(Oc2ncc(C(F)(F)F)cc2Cl)nn1/C([O-])=N/C |
| InChI | InChI=1S/C13H12ClF3N4O2/c1-3-8-5-10(20-21(8)12(22)18-2)23-11-9(14)4-7(6-19-11)13(15,16)17/h4-6H,3H2,1-2H3,(H,18,22)/p-1 |
| InChIKey | GARBNXUBNRKJLE-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|