C16H15ClF3NO3 — CID 69318802
[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-(ethoxymethyl)phenyl]methanol (PubChem CID 69318802) has the molecular formula C16H15ClF3NO3 and a molecular weight of 361.75 g/mol. Its IUPAC name is [3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-(ethoxymethyl)phenyl]methanol.
| Compound Name | [3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-(ethoxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 69318802 |
| Molecular Formula | C16H15ClF3NO3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | [3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-(ethoxymethyl)phenyl]methanol |
| SMILES | CCOCc1cc(CO)cc(Oc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C16H15ClF3NO3/c1-2-23-9-11-3-10(8-22)4-13(5-11)24-15-14(17)6-12(7-21-15)16(18,19)20/h3-7,22H,2,8-9H2,1H3 |
| InChIKey | REHQJNHSPCKUCB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |