C14H12ClF3N4OS — CID 91003267
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-N-prop-2-enylpyrazole-1-carbothioamide (PubChem CID 91003267) has the molecular formula C14H12ClF3N4OS and a molecular weight of 376.79 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-N-prop-2-enylpyrazole-1-carbothioamide.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-N-prop-2-enylpyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 91003267 |
| Molecular Formula | C14H12ClF3N4OS |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-5-methyl-N-prop-2-enylpyrazole-1-carbothioamide |
| SMILES | C=CCNC(=S)n1nc(Oc2ncc(C(F)(F)F)cc2Cl)cc1C |
| InChI | InChI=1S/C14H12ClF3N4OS/c1-3-4-19-13(24)22-8(2)5-11(21-22)23-12-10(15)6-9(7-20-12)14(16,17)18/h3,5-7H,1,4H2,2H3,(H,19,24) |
| InChIKey | ZXNCPVUUDJSHOI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|