C12H14ClF3N4S — CID 3334246
1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-prop-2-enylthiourea (PubChem CID 3334246) has the molecular formula C12H14ClF3N4S and a molecular weight of 338.79 g/mol. Its IUPAC name is 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3334246 |
| Molecular Formula | C12H14ClF3N4S |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NCCNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H14ClF3N4S/c1-2-3-18-11(21)19-5-4-17-10-9(13)6-8(7-20-10)12(14,15)16/h2,6-7H,1,3-5H2,(H,17,20)(H2,18,19,21) |
| InChIKey | DXLPZBRTKOZHOY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|