C15H14F3N5O — CID 162514154
4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-6-ol (PubChem CID 162514154) has the molecular formula C15H14F3N5O and a molecular weight of 337.31 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-6-ol.
| Compound Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-6-ol |
|---|---|
| PubChem CID | 162514154 |
| Molecular Formula | C15H14F3N5O |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]pyrrolo[2,1-f][1,2,4]triazin-6-ol |
| SMILES | C[C@@H](Nc1ncnn2cc(O)cc12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F3N5O/c1-8(9-2-10(15(16,17)18)4-11(19)3-9)22-14-13-5-12(24)6-23(13)21-7-20-14/h2-8,24H,19H2,1H3,(H,20,21,22)/t8-/m1/s1 |
| InChIKey | AWGUTODCPYEGNO-MRVPVSSYSA-N |
| XLogP | 3.21 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|