C17H17F3N4O3 — CID 162514231
N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-N-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]formamide (PubChem CID 162514231) has the molecular formula C17H17F3N4O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-N-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]formamide.
| Compound Name | N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-N-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]formamide |
|---|---|
| PubChem CID | 162514231 |
| Molecular Formula | C17H17F3N4O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-[[(4R)-4-cyclopropyl-2,5-dioxoimidazolidin-4-yl]methyl]-N-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]formamide |
| SMILES | O=CN(C[C@@]1(C2CC2)NC(=O)NC1=O)N1Cc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C17H17F3N4O3/c18-17(19,20)13-2-1-10-6-23(7-11(10)5-13)24(9-25)8-16(12-3-4-12)14(26)21-15(27)22-16/h1-2,5,9,12H,3-4,6-8H2,(H2,21,22,26,27)/t16-/m0/s1 |
| InChIKey | YDUZWSDMOQEMKU-INIZCTEOSA-N |
| XLogP | 1.38 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|