C14H18N2O2S — CID 162515240
3-cyclohexyl-4-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 162515240) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-cyclohexyl-4-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-cyclohexyl-4-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 162515240 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-cyclohexyl-4-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CN1C(C2CCCCC2)=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O2S/c1-16-12-9-5-6-10-13(12)19(17,18)15-14(16)11-7-3-2-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3 |
| InChIKey | OXAXMSNCULRKLH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |