C10H12N2O2S — CID 16732469
4-ethyl-7-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 16732469) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-ethyl-7-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 4-ethyl-7-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 16732469 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-ethyl-7-methyl-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCN1C=NS(=O)(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C10H12N2O2S/c1-3-12-7-11-15(13,14)10-6-8(2)4-5-9(10)12/h4-7H,3H2,1-2H3 |
| InChIKey | CURBFTXDLIKLFV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |