C34H44N4O5 — CID 162515872
(2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]butanoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide (PubChem CID 162515872) has the molecular formula C34H44N4O5 and a molecular weight of 588.75 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]butanoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide.
| Compound Name | (2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]butanoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 162515872 |
| Molecular Formula | C34H44N4O5 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | (2S)-4-methyl-2-[[(2S)-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]butanoyl]amino]-N-[(2S)-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)/C=C/c1ccc(-c2ccccc2)cc1)C(C)C)C(=O)N[C@H](C=O)C[C@@H]1CCCNC1=O |
| InChI | InChI=1S/C34H44N4O5/c1-22(2)19-29(33(42)36-28(21-39)20-27-11-8-18-35-32(27)41)37-34(43)31(23(3)4)38-30(40)17-14-24-12-15-26(16-13-24)25-9-6-5-7-10-25/h5-7,9-10,12-17,21-23,27-29,31H,8,11,18-20H2,1-4H3,(H,35,41)(H,36,42)(H,37,43)(H,38,40)/b17-14+/t27-,28-,29-,31-/m0/s1 |
| InChIKey | SXGHUUUXHGJESI-MFZWHCTPSA-N |
| XLogP | 3.64 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|