C8H16N4O3 — CID 162519150
5-(2-aminohydrazinyl)-2-(prop-2-enoylamino)pentanoic acid (PubChem CID 162519150) has the molecular formula C8H16N4O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 5-(2-aminohydrazinyl)-2-(prop-2-enoylamino)pentanoic acid.
| Compound Name | 5-(2-aminohydrazinyl)-2-(prop-2-enoylamino)pentanoic acid |
|---|---|
| PubChem CID | 162519150 |
| Molecular Formula | C8H16N4O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 5-(2-aminohydrazinyl)-2-(prop-2-enoylamino)pentanoic acid |
| SMILES | C=CC(=O)NC(CCCNNN)C(=O)O |
| InChI | InChI=1S/C8H16N4O3/c1-2-7(13)11-6(8(14)15)4-3-5-10-12-9/h2,6,10,12H,1,3-5,9H2,(H,11,13)(H,14,15) |
| InChIKey | MPGUTFTWMVSTTB-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|