C15H22N4O6 — CID 70885029
2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-hydrazinyl-5-oxopentanoic acid (PubChem CID 70885029) has the molecular formula C15H22N4O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-hydrazinyl-5-oxopentanoic acid.
| Compound Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-hydrazinyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70885029 |
| Molecular Formula | C15H22N4O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-5-hydrazinyl-5-oxopentanoic acid |
| SMILES | NNC(=O)CCC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C15H22N4O6/c16-18-12(21)6-5-10(15(24)25)17-11(20)4-2-1-3-9-19-13(22)7-8-14(19)23/h7-8,10H,1-6,9,16H2,(H,17,20)(H,18,21)(H,24,25) |
| InChIKey | WISJHCUASFYGJF-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|