C26H39N7O11 — CID 54572007
(4S)-4-amino-5-[[3-[2-[3-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-oxopropyl]amino]-5-oxopentanoic acid (PubChem CID 54572007) has the molecular formula C26H39N7O11 and a molecular weight of 625.64 g/mol. Its IUPAC name is (4S)-4-amino-5-[[3-[2-[3-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-oxopropyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[[3-[2-[3-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-oxopropyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54572007 |
| Molecular Formula | C26H39N7O11 |
| Molecular Weight | 625.64 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | (4S)-4-amino-5-[[3-[2-[3-[[(2S)-2-amino-4-carboxybutanoyl]amino]propanoyl]-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-3-oxopropyl]amino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)O)C(=O)NCCC(=O)NN(C(=O)CCCCCN1C(=O)C=CC1=O)C(=O)CCNC(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C26H39N7O11/c27-16(5-9-23(39)40)25(43)29-13-11-18(34)31-33(22(38)12-14-30-26(44)17(28)6-10-24(41)42)21(37)4-2-1-3-15-32-19(35)7-8-20(32)36/h7-8,16-17H,1-6,9-15,27-28H2,(H,29,43)(H,30,44)(H,31,34)(H,39,40)(H,41,42)/t16-,17-/m0/s1 |
| InChIKey | ZXYNOQNNSDRTGT-IRXDYDNUSA-N |
| XLogP | -2.74 |
| TPSA | 288.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.64 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|