C14H20N2O5 — CID 68753882
(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]propanoic acid (PubChem CID 68753882) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]propanoic acid.
| Compound Name | (2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 68753882 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl-methylamino]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N(C)C(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H20N2O5/c1-10(14(20)21)15(2)11(17)6-4-3-5-9-16-12(18)7-8-13(16)19/h7-8,10H,3-6,9H2,1-2H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | MRLFQZZCESDTSL-JTQLQIEISA-N |
| XLogP | 0.40 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|