C15H20N2O7 — CID 155040596
2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanedioic acid (PubChem CID 155040596) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanedioic acid.
| Compound Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 155040596 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C15H20N2O7/c18-11(16-10(15(23)24)5-8-14(21)22)4-2-1-3-9-17-12(19)6-7-13(17)20/h6-7,10H,1-5,8-9H2,(H,16,18)(H,21,22)(H,23,24) |
| InChIKey | KOWIDELKBOMETP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|