C14H18N4O8S — CID 175089835
5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(2,5-dioxopyrrol-1-yl)amino]-5-oxopentanoic acid (PubChem CID 175089835) has the molecular formula C14H18N4O8S and a molecular weight of 402.39 g/mol. Its IUPAC name is 5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(2,5-dioxopyrrol-1-yl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(2,5-dioxopyrrol-1-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175089835 |
| Molecular Formula | C14H18N4O8S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-[(2,5-dioxopyrrol-1-yl)amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CNC(=O)C(CS)NC(=O)CCC(NN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C14H18N4O8S/c19-9(16-8(6-27)13(24)15-5-12(22)23)2-1-7(14(25)26)17-18-10(20)3-4-11(18)21/h3-4,7-8,17,27H,1-2,5-6H2,(H,15,24)(H,16,19)(H,22,23)(H,25,26) |
| InChIKey | JABRAHZOAQLJOK-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|