C16H24N4O7S — CID 70686865
2-amino-5-[[1-(carboxymethylamino)-3-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]propan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 70686865) has the molecular formula C16H24N4O7S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-3-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]propan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-3-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]propan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70686865 |
| Molecular Formula | C16H24N4O7S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-3-[2-(2,5-dioxopyrrol-1-yl)ethylsulfanyl]propan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CNCC(=O)O)CSCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C16H24N4O7S/c17-11(16(26)27)1-2-12(21)19-10(7-18-8-15(24)25)9-28-6-5-20-13(22)3-4-14(20)23/h3-4,10-11,18H,1-2,5-9,17H2,(H,19,21)(H,24,25)(H,26,27) |
| InChIKey | TXRKDNOJTOUSNJ-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|