C15H10FNO3 — CID 162519491
methyl 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoate (PubChem CID 162519491) has the molecular formula C15H10FNO3 and a molecular weight of 271.25 g/mol. Its IUPAC name is methyl 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoate.
| Compound Name | methyl 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoate |
|---|---|
| PubChem CID | 162519491 |
| Molecular Formula | C15H10FNO3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | methyl 2-fluoro-4-furo[3,2-c]pyridin-4-ylbenzoate |
| SMILES | COC(=O)c1ccc(-c2nccc3occc23)cc1F |
| InChI | InChI=1S/C15H10FNO3/c1-19-15(18)10-3-2-9(8-12(10)16)14-11-5-7-20-13(11)4-6-17-14/h2-8H,1H3 |
| InChIKey | CJURAZIEBAJDPT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |