C17H15NO4 — CID 162519642
ethyl 4-[6-(hydroxymethyl)furo[3,2-c]pyridin-4-yl]benzoate (PubChem CID 162519642) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 4-[6-(hydroxymethyl)furo[3,2-c]pyridin-4-yl]benzoate.
| Compound Name | ethyl 4-[6-(hydroxymethyl)furo[3,2-c]pyridin-4-yl]benzoate |
|---|---|
| PubChem CID | 162519642 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethyl 4-[6-(hydroxymethyl)furo[3,2-c]pyridin-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2nc(CO)cc3occc23)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-2-21-17(20)12-5-3-11(4-6-12)16-14-7-8-22-15(14)9-13(10-19)18-16/h3-9,19H,2,10H2,1H3 |
| InChIKey | OCELBNRFXSRLHA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |