C13H7BClF3N2O3 — CID 162520155
CID 162520155 (PubChem CID 162520155) has the molecular formula C13H7BClF3N2O3 and a molecular weight of 342.47 g/mol.
| Compound Name | CID 162520155 |
|---|---|
| PubChem CID | 162520155 |
| Molecular Formula | C13H7BClF3N2O3 |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)c1ncc(-c2c(C(F)F)ccc(Cl)c2F)nc1C=O |
| InChI | InChI=1S/C13H7BClF3N2O3/c14-13(22,23)11-8(4-21)20-7(3-19-11)9-5(12(17)18)1-2-6(15)10(9)16/h1-4,12,22-23H |
| InChIKey | DUJWVZKUCOGRSX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|