C28H26N4O2S — CID 162520949
3-[[2-(2-amino-3-methylphenyl)acetyl]amino]-N-(4-anilinosulfanylphenyl)benzamide (PubChem CID 162520949) has the molecular formula C28H26N4O2S and a molecular weight of 482.61 g/mol. Its IUPAC name is 3-[[2-(2-amino-3-methylphenyl)acetyl]amino]-N-(4-anilinosulfanylphenyl)benzamide.
| Compound Name | 3-[[2-(2-amino-3-methylphenyl)acetyl]amino]-N-(4-anilinosulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 162520949 |
| Molecular Formula | C28H26N4O2S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 3-[[2-(2-amino-3-methylphenyl)acetyl]amino]-N-(4-anilinosulfanylphenyl)benzamide |
| SMILES | Cc1cccc(CC(=O)Nc2cccc(C(=O)Nc3ccc(SNc4ccccc4)cc3)c2)c1N |
| InChI | InChI=1S/C28H26N4O2S/c1-19-7-5-8-20(27(19)29)18-26(33)30-24-12-6-9-21(17-24)28(34)31-22-13-15-25(16-14-22)35-32-23-10-3-2-4-11-23/h2-17,32H,18,29H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | LVYFDTNDHPOUPU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|