C21H20N4O2S — CID 162521609
3-[[2-(2-aminophenyl)acetyl]amino]-N-(4-aminosulfanylphenyl)benzamide (PubChem CID 162521609) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-[[2-(2-aminophenyl)acetyl]amino]-N-(4-aminosulfanylphenyl)benzamide.
| Compound Name | 3-[[2-(2-aminophenyl)acetyl]amino]-N-(4-aminosulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 162521609 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-[[2-(2-aminophenyl)acetyl]amino]-N-(4-aminosulfanylphenyl)benzamide |
| SMILES | NSc1ccc(NC(=O)c2cccc(NC(=O)Cc3ccccc3N)c2)cc1 |
| InChI | InChI=1S/C21H20N4O2S/c22-19-7-2-1-4-14(19)13-20(26)24-17-6-3-5-15(12-17)21(27)25-16-8-10-18(28-23)11-9-16/h1-12H,13,22-23H2,(H,24,26)(H,25,27) |
| InChIKey | LRIIXGQVGWDAKB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|