About ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline
ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline (PubChem CID 162521035) has the molecular formula C16H25FN2
and a molecular weight of 264.39 g/mol. Its IUPAC name is ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline.
Molecular Properties
| Compound Name | ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline |
| PubChem CID | 162521035 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline |
| SMILES | C/C=C\C(=C/C)N(C)Cc1cccc(N)c1F.CC |
| InChI | InChI=1S/C14H19FN2.C2H6/c1-4-7-12(5-2)17(3)10-11-8-6-9-13(16)14(11)15;1-2/h4-9H,10,16H2,1-3H3;1-2H3/b7-4-,12-5+; |
| InChIKey | IECHUXIYSPEEDP-VACVELDKSA-N |
| XLogP | 4.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline?
The IUPAC name of ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline (CID 162521035) is ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline.
What is the SMILES notation for ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline?
The canonical SMILES for ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline is C/C=C\C(=C/C)N(C)Cc1cccc(N)c1F.CC.
What is the InChIKey of ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline?
The InChIKey is IECHUXIYSPEEDP-VACVELDKSA-N. The full InChI is InChI=1S/C14H19FN2.C2H6/c1-4-7-12(5-2)17(3)10-11-8-6-9-13(16)14(11)15;1-2/h4-9H,10,16H2,1-3H3;1-2H3/b7-4-,12-5+;.
What are the key properties of ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline?
ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline has a molecular weight of 264.39 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-3-[[[(2E,4Z)-hexa-2,4-dien-3-yl]-methylamino]methyl]aniline is sourced from PubChem (CID 162521035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).