C22H22ClN3O — CID 162521310
N'-[5-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-2-methylphenyl]methanimidamide (PubChem CID 162521310) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is N'-[5-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-2-methylphenyl]methanimidamide.
| Compound Name | N'-[5-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-2-methylphenyl]methanimidamide |
|---|---|
| PubChem CID | 162521310 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N'-[5-[[4-[(3-chlorophenyl)methoxy]phenyl]methylamino]-2-methylphenyl]methanimidamide |
| SMILES | Cc1ccc(NCc2ccc(OCc3cccc(Cl)c3)cc2)cc1/N=C/N |
| InChI | InChI=1S/C22H22ClN3O/c1-16-5-8-20(12-22(16)26-15-24)25-13-17-6-9-21(10-7-17)27-14-18-3-2-4-19(23)11-18/h2-12,15,25H,13-14H2,1H3,(H2,24,26) |
| InChIKey | HBTFCNBPYSBVQW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|