C17H20N5O3P — CID 162521892
[4-[(5-methyl-7-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)methyl]phenyl]phosphonic acid (PubChem CID 162521892) has the molecular formula C17H20N5O3P and a molecular weight of 373.35 g/mol. Its IUPAC name is [4-[(5-methyl-7-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)methyl]phenyl]phosphonic acid.
| Compound Name | [4-[(5-methyl-7-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)methyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 162521892 |
| Molecular Formula | C17H20N5O3P |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [4-[(5-methyl-7-pyrrolidin-1-yl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)methyl]phenyl]phosphonic acid |
| SMILES | Cc1nc2ncnn2c(N2CCCC2)c1Cc1ccc(P(=O)(O)O)cc1 |
| InChI | InChI=1S/C17H20N5O3P/c1-12-15(10-13-4-6-14(7-5-13)26(23,24)25)16(21-8-2-3-9-21)22-17(20-12)18-11-19-22/h4-7,11H,2-3,8-10H2,1H3,(H2,23,24,25) |
| InChIKey | NBVHJUPAKLPATO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|