C22H26N6O — CID 46098334
1-[4-(6-benzyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-methylbut-2-en-1-one (PubChem CID 46098334) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[4-(6-benzyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[4-(6-benzyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 46098334 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[4-(6-benzyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1CCN(c2c(Cc3ccccc3)c(C)nc3ncnn23)CC1 |
| InChI | InChI=1S/C22H26N6O/c1-16(2)13-20(29)26-9-11-27(12-10-26)21-19(14-18-7-5-4-6-8-18)17(3)25-22-23-15-24-28(21)22/h4-8,13,15H,9-12,14H2,1-3H3 |
| InChIKey | XJUZTXGIGFOBBD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|