C26H29ClN6O2 — CID 162526538
N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]prop-2-enamide (PubChem CID 162526538) has the molecular formula C26H29ClN6O2 and a molecular weight of 493.01 g/mol. Its IUPAC name is N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]prop-2-enamide.
| Compound Name | N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 162526538 |
| Molecular Formula | C26H29ClN6O2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-(5-aminopentyl)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]prop-2-enamide |
| SMILES | C=C(C(=O)NCCCCCN)[C@@H]1N=C(c2ccc(Cl)cc2)c2cc(OC)ccc2-n2c(C)nnc21 |
| InChI | InChI=1S/C26H29ClN6O2/c1-16(26(34)29-14-6-4-5-13-28)23-25-32-31-17(2)33(25)22-12-11-20(35-3)15-21(22)24(30-23)18-7-9-19(27)10-8-18/h7-12,15,23H,1,4-6,13-14,28H2,2-3H3,(H,29,34)/t23-/m0/s1 |
| InChIKey | DTIQIWKTNHMIBW-QHCPKHFHSA-N |
| XLogP | 3.93 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|