C32H33ClN6O5 — CID 78051344
N-[5-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentyl]-2,3-dihydroxybenzamide (PubChem CID 78051344) has the molecular formula C32H33ClN6O5 and a molecular weight of 617.11 g/mol. Its IUPAC name is N-[5-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[5-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 78051344 |
| Molecular Formula | C32H33ClN6O5 |
| Molecular Weight | 617.11 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | N-[5-[[2-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]pentyl]-2,3-dihydroxybenzamide |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(CC(=O)NCCCCCNC(=O)c1cccc(O)c1O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C32H33ClN6O5/c1-19-37-38-31-25(18-28(41)34-15-4-3-5-16-35-32(43)23-7-6-8-27(40)30(23)42)36-29(20-9-11-21(33)12-10-20)24-17-22(44-2)13-14-26(24)39(19)31/h6-14,17,25,40,42H,3-5,15-16,18H2,1-2H3,(H,34,41)(H,35,43) |
| InChIKey | QORGLFWELIFSPU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.11 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|