C33H35ClN6O7 — CID 71291675
N-[2-[2-[2-[[2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,3-dihydroxybenzamide (PubChem CID 71291675) has the molecular formula C33H35ClN6O7 and a molecular weight of 663.13 g/mol. Its IUPAC name is N-[2-[2-[2-[[2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[2-[2-[2-[[2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 71291675 |
| Molecular Formula | C33H35ClN6O7 |
| Molecular Weight | 663.13 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | N-[2-[2-[2-[[2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetyl]amino]ethoxy]ethoxy]ethyl]-2,3-dihydroxybenzamide |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NCCOCCOCCNC(=O)c1cccc(O)c1O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C33H35ClN6O7/c1-20-38-39-32-26(37-30(21-6-8-22(34)9-7-21)25-18-23(45-2)10-11-27(25)40(20)32)19-29(42)35-12-14-46-16-17-47-15-13-36-33(44)24-4-3-5-28(41)31(24)43/h3-11,18,26,41,43H,12-17,19H2,1-2H3,(H,35,42)(H,36,44)/t26-/m0/s1 |
| InChIKey | ZBISQTUHTRCABA-SANMLTNESA-N |
| XLogP | 3.51 |
| TPSA | 169.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.13 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|