C20H18N4O2 — CID 162527377
1-(2-carbamoylprop-2-enylamino)-7-pyridin-3-ylnaphthalene-2-carboxamide (PubChem CID 162527377) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-(2-carbamoylprop-2-enylamino)-7-pyridin-3-ylnaphthalene-2-carboxamide.
| Compound Name | 1-(2-carbamoylprop-2-enylamino)-7-pyridin-3-ylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 162527377 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-(2-carbamoylprop-2-enylamino)-7-pyridin-3-ylnaphthalene-2-carboxamide |
| SMILES | C=C(CNc1c(C(N)=O)ccc2ccc(-c3cccnc3)cc12)C(N)=O |
| InChI | InChI=1S/C20H18N4O2/c1-12(19(21)25)10-24-18-16(20(22)26)7-6-13-4-5-14(9-17(13)18)15-3-2-8-23-11-15/h2-9,11,24H,1,10H2,(H2,21,25)(H2,22,26) |
| InChIKey | UTOHUDBMUGTINC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|