C32H37N5O3 — CID 162527631
6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[[4-[2-methoxyethyl(methyl)amino]cyclohexyl]methylidene]pyridine-2-carboxamide (PubChem CID 162527631) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[[4-[2-methoxyethyl(methyl)amino]cyclohexyl]methylidene]pyridine-2-carboxamide.
| Compound Name | 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[[4-[2-methoxyethyl(methyl)amino]cyclohexyl]methylidene]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162527631 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 6-[8-(2-cyanoprop-2-enylamino)-7-methoxynaphthalen-2-yl]-N-[[4-[2-methoxyethyl(methyl)amino]cyclohexyl]methylidene]pyridine-2-carboxamide |
| SMILES | C=C(C#N)CNc1c(OC)ccc2ccc(-c3cccc(C(=O)/N=C/C4CCC(N(C)CCOC)CC4)n3)cc12 |
| InChI | InChI=1S/C32H37N5O3/c1-22(19-33)20-34-31-27-18-25(11-10-24(27)12-15-30(31)40-4)28-6-5-7-29(36-28)32(38)35-21-23-8-13-26(14-9-23)37(2)16-17-39-3/h5-7,10-12,15,18,21,23,26,34H,1,8-9,13-14,16-17,20H2,2-4H3/b35-21+ |
| InChIKey | XEOZISGOIBPCGE-XICOUIIWSA-N |
| XLogP | 5.75 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|