C17H15N3O — CID 162528335
7-methyl-4-(1-methylindazol-6-yl)-2,3-dihydroisoindol-1-one (PubChem CID 162528335) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 7-methyl-4-(1-methylindazol-6-yl)-2,3-dihydroisoindol-1-one.
| Compound Name | 7-methyl-4-(1-methylindazol-6-yl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 162528335 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 7-methyl-4-(1-methylindazol-6-yl)-2,3-dihydroisoindol-1-one |
| SMILES | Cc1ccc(-c2ccc3cnn(C)c3c2)c2c1C(=O)NC2 |
| InChI | InChI=1S/C17H15N3O/c1-10-3-6-13(14-9-18-17(21)16(10)14)11-4-5-12-8-19-20(2)15(12)7-11/h3-8H,9H2,1-2H3,(H,18,21) |
| InChIKey | OYLZNSBAYQBJFR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |