C19H17N3O2 — CID 162528916
4-(1-methylindazol-6-yl)-2-[[(2R)-oxiran-2-yl]methyl]-3H-isoindol-1-one (PubChem CID 162528916) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-(1-methylindazol-6-yl)-2-[[(2R)-oxiran-2-yl]methyl]-3H-isoindol-1-one.
| Compound Name | 4-(1-methylindazol-6-yl)-2-[[(2R)-oxiran-2-yl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 162528916 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4-(1-methylindazol-6-yl)-2-[[(2R)-oxiran-2-yl]methyl]-3H-isoindol-1-one |
| SMILES | Cn1ncc2ccc(-c3cccc4c3CN(C[C@@H]3CO3)C4=O)cc21 |
| InChI | InChI=1S/C19H17N3O2/c1-21-18-7-12(5-6-13(18)8-20-21)15-3-2-4-16-17(15)10-22(19(16)23)9-14-11-24-14/h2-8,14H,9-11H2,1H3/t14-/m1/s1 |
| InChIKey | OVMHBPJGXHHOAF-CQSZACIVSA-N |
| XLogP | 2.59 |
| TPSA | 50.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|