C19H17N3O3 — CID 162529218
7-amino-4-(3-methyl-1,2-benzoxazol-5-yl)-2-(oxiran-2-ylmethyl)-3H-isoindol-1-one (PubChem CID 162529218) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 7-amino-4-(3-methyl-1,2-benzoxazol-5-yl)-2-(oxiran-2-ylmethyl)-3H-isoindol-1-one.
| Compound Name | 7-amino-4-(3-methyl-1,2-benzoxazol-5-yl)-2-(oxiran-2-ylmethyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 162529218 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 7-amino-4-(3-methyl-1,2-benzoxazol-5-yl)-2-(oxiran-2-ylmethyl)-3H-isoindol-1-one |
| SMILES | Cc1noc2ccc(-c3ccc(N)c4c3CN(CC3CO3)C4=O)cc12 |
| InChI | InChI=1S/C19H17N3O3/c1-10-14-6-11(2-5-17(14)25-21-10)13-3-4-16(20)18-15(13)8-22(19(18)23)7-12-9-24-12/h2-6,12H,7-9,20H2,1H3 |
| InChIKey | FFEFZEULWAZMRU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|