C20H26Cl2N4S2 — CID 162532376
3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6-benzyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;dihydrochloride (PubChem CID 162532376) has the molecular formula C20H26Cl2N4S2 and a molecular weight of 457.50 g/mol. Its IUPAC name is 3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6-benzyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;dihydrochloride.
| Compound Name | 3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6-benzyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;dihydrochloride |
|---|---|
| PubChem CID | 162532376 |
| Molecular Formula | C20H26Cl2N4S2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6-benzyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole;dihydrochloride |
| SMILES | C1=C(CSC2=N[C@@H]3CCCC[C@H]3N2)N2CC(Cc3ccccc3)N=C2S1.Cl.Cl |
| InChI | InChI=1S/C20H24N4S2.2ClH/c1-2-6-14(7-3-1)10-15-11-24-16(13-26-20(24)21-15)12-25-19-22-17-8-4-5-9-18(17)23-19;;/h1-3,6-7,13,15,17-18H,4-5,8-12H2,(H,22,23);2*1H/t15?,17-,18-;;/m1../s1 |
| InChIKey | HNUNWJAMRXALOX-PYQYEIPKSA-N |
| XLogP | 4.70 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |