C15H19ClN2OS — CID 41187397
(3aS,7aS)-2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole (PubChem CID 41187397) has the molecular formula C15H19ClN2OS and a molecular weight of 310.85 g/mol. Its IUPAC name is (3aS,7aS)-2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole.
| Compound Name | (3aS,7aS)-2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 41187397 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (3aS,7aS)-2-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole |
| SMILES | COc1ccc(Cl)cc1CSC1=N[C@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C15H19ClN2OS/c1-19-14-7-6-11(16)8-10(14)9-20-15-17-12-4-2-3-5-13(12)18-15/h6-8,12-13H,2-5,9H2,1H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | ODDKGRZCRWWFJM-STQMWFEESA-N |
| XLogP | 3.85 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |