C16H21BrN2O2S — CID 26008367
(3aR,7aR)-2-[(2-bromo-4,5-dimethoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole (PubChem CID 26008367) has the molecular formula C16H21BrN2O2S and a molecular weight of 385.33 g/mol. Its IUPAC name is (3aR,7aR)-2-[(2-bromo-4,5-dimethoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole.
| Compound Name | (3aR,7aR)-2-[(2-bromo-4,5-dimethoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 26008367 |
| Molecular Formula | C16H21BrN2O2S |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (3aR,7aR)-2-[(2-bromo-4,5-dimethoxyphenyl)methylsulfanyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole |
| SMILES | COc1cc(Br)c(CSC2=N[C@@H]3CCCC[C@H]3N2)cc1OC |
| InChI | InChI=1S/C16H21BrN2O2S/c1-20-14-7-10(11(17)8-15(14)21-2)9-22-16-18-12-5-3-4-6-13(12)19-16/h7-8,12-13H,3-6,9H2,1-2H3,(H,18,19)/t12-,13-/m1/s1 |
| InChIKey | ICNQJRZYMQKONC-CHWSQXEVSA-N |
| XLogP | 3.97 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |