C9H8FNO4 — CID 162532885
7-amino-5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid (PubChem CID 162532885) has the molecular formula C9H8FNO4 and a molecular weight of 213.16 g/mol. Its IUPAC name is 7-amino-5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid.
| Compound Name | 7-amino-5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid |
|---|---|
| PubChem CID | 162532885 |
| Molecular Formula | C9H8FNO4 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 7-amino-5-fluoro-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid |
| SMILES | Nc1cc2c(c(F)c1C(=O)O)OCCO2 |
| InChI | InChI=1S/C9H8FNO4/c10-7-6(9(12)13)4(11)3-5-8(7)15-2-1-14-5/h3H,1-2,11H2,(H,12,13) |
| InChIKey | GARKBQKEAFGKNE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|