C17H17Cl2N5O3S — CID 162533595
2-[[7-chloro-1-(2-chlorophenyl)-2-oxopyrido[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide (PubChem CID 162533595) has the molecular formula C17H17Cl2N5O3S and a molecular weight of 442.33 g/mol. Its IUPAC name is 2-[[7-chloro-1-(2-chlorophenyl)-2-oxopyrido[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide.
| Compound Name | 2-[[7-chloro-1-(2-chlorophenyl)-2-oxopyrido[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 162533595 |
| Molecular Formula | C17H17Cl2N5O3S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-[[7-chloro-1-(2-chlorophenyl)-2-oxopyrido[2,3-d]pyrimidin-4-yl]amino]-N,N-dimethylethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)CCNc1nc(=O)n(-c2ccccc2Cl)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C17H17Cl2N5O3S/c1-23(2)28(26,27)10-9-20-15-11-7-8-14(19)21-16(11)24(17(25)22-15)13-6-4-3-5-12(13)18/h3-8H,9-10H2,1-2H3,(H,20,22,25) |
| InChIKey | AJSCNUCGYMAOAE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|