C17H16Cl2N4O2S — CID 45380043
2-[(2,6-dichloroquinazolin-4-yl)amino]-N-methyl-N-phenylethanesulfonamide (PubChem CID 45380043) has the molecular formula C17H16Cl2N4O2S and a molecular weight of 411.31 g/mol. Its IUPAC name is 2-[(2,6-dichloroquinazolin-4-yl)amino]-N-methyl-N-phenylethanesulfonamide.
| Compound Name | 2-[(2,6-dichloroquinazolin-4-yl)amino]-N-methyl-N-phenylethanesulfonamide |
|---|---|
| PubChem CID | 45380043 |
| Molecular Formula | C17H16Cl2N4O2S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[(2,6-dichloroquinazolin-4-yl)amino]-N-methyl-N-phenylethanesulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)CCNc1nc(Cl)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H16Cl2N4O2S/c1-23(13-5-3-2-4-6-13)26(24,25)10-9-20-16-14-11-12(18)7-8-15(14)21-17(19)22-16/h2-8,11H,9-10H2,1H3,(H,20,21,22) |
| InChIKey | CMPKLWKVQOYEIJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |