C10H10Cl2N4O2S — CID 45380048
2-[(2,6-dichloroquinazolin-4-yl)amino]ethanesulfonamide (PubChem CID 45380048) has the molecular formula C10H10Cl2N4O2S and a molecular weight of 321.19 g/mol. Its IUPAC name is 2-[(2,6-dichloroquinazolin-4-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(2,6-dichloroquinazolin-4-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 45380048 |
| Molecular Formula | C10H10Cl2N4O2S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-[(2,6-dichloroquinazolin-4-yl)amino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1nc(Cl)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H10Cl2N4O2S/c11-6-1-2-8-7(5-6)9(16-10(12)15-8)14-3-4-19(13,17)18/h1-2,5H,3-4H2,(H2,13,17,18)(H,14,15,16) |
| InChIKey | FNCUTBYDABXJEW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |