C7H11F3O8S — CID 162534517
[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] trifluoromethanesulfonate (PubChem CID 162534517) has the molecular formula C7H11F3O8S and a molecular weight of 312.22 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162534517 |
| Molecular Formula | C7H11F3O8S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3O8S/c8-7(9,10)19(15,16)18-6-5(14)4(13)3(12)2(1-11)17-6/h2-6,11-14H,1H2/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | OEXSCEJGPUGDJF-VFUOTHLCSA-N |
| XLogP | -2.35 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|