C14H23F3N2O3 — CID 162537263
tert-butyl N-[2-[(2,2,2-trifluoroacetyl)amino]hept-6-en-3-yl]carbamate (PubChem CID 162537263) has the molecular formula C14H23F3N2O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,2,2-trifluoroacetyl)amino]hept-6-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[2-[(2,2,2-trifluoroacetyl)amino]hept-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 162537263 |
| Molecular Formula | C14H23F3N2O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl N-[2-[(2,2,2-trifluoroacetyl)amino]hept-6-en-3-yl]carbamate |
| SMILES | C=CCCC(NC(=O)OC(C)(C)C)C(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H23F3N2O3/c1-6-7-8-10(19-12(21)22-13(3,4)5)9(2)18-11(20)14(15,16)17/h6,9-10H,1,7-8H2,2-5H3,(H,18,20)(H,19,21) |
| InChIKey | UHOALFLYZKYVLR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|