About 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile
5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile (PubChem CID 162539224) has the molecular formula C6HF3N4
and a molecular weight of 186.10 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile.
Analyze 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile?
The IUPAC name of 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile (CID 162539224) is 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile.
What is the SMILES notation for 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile?
The canonical SMILES for 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile is N#Cc1nc(C#N)c(C(F)(F)F)[nH]1.
What is the InChIKey of 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile?
The InChIKey is YIQYTFSOLIJNGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HF3N4/c7-6(8,9)5-3(1-10)12-4(2-11)13-5/h(H,12,13).
What are the key properties of 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile?
5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile has a molecular weight of 186.10 g/mol, XLogP of 1.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-1H-imidazole-2,4-dicarbonitrile is sourced from PubChem (CID 162539224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).